C36H34F3N5O3+2 — CID 123654688
5-[3-[4-[1-(4-aminoanilino)-5-oxopenta-1,3-dien-3-yl]pyridin-1-ium-1-yl]propylamino]-3-[1-[4-(trifluoromethoxy)phenyl]pyridin-1-ium-4-yl]penta-2,4-dienal (PubChem CID 123654688) has the molecular formula C36H34F3N5O3+2 and a molecular weight of 641.69 g/mol. Its IUPAC name is 5-[3-[4-[1-(4-aminoanilino)-5-oxopenta-1,3-dien-3-yl]pyridin-1-ium-1-yl]propylamino]-3-[1-[4-(trifluoromethoxy)phenyl]pyridin-1-ium-4-yl]penta-2,4-dienal.
| Compound Name | 5-[3-[4-[1-(4-aminoanilino)-5-oxopenta-1,3-dien-3-yl]pyridin-1-ium-1-yl]propylamino]-3-[1-[4-(trifluoromethoxy)phenyl]pyridin-1-ium-4-yl]penta-2,4-dienal |
|---|---|
| PubChem CID | 123654688 |
| Molecular Formula | C36H34F3N5O3+2 |
| Molecular Weight | 641.69 g/mol |
| Exact Mass | 641.26 |
| IUPAC Name | 5-[3-[4-[1-(4-aminoanilino)-5-oxopenta-1,3-dien-3-yl]pyridin-1-ium-1-yl]propylamino]-3-[1-[4-(trifluoromethoxy)phenyl]pyridin-1-ium-4-yl]penta-2,4-dienal |
| SMILES | Nc1ccc(NC=CC(=CC=O)c2cc[n+](CCCNC=CC(=CC=O)c3cc[n+](-c4ccc(OC(F)(F)F)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C36H32F3N5O3/c37-36(38,39)47-35-8-6-34(7-9-35)44-24-14-31(15-25-44)28(16-26-45)10-19-41-18-1-21-43-22-12-30(13-23-43)29(17-27-46)11-20-42-33-4-2-32(40)3-5-33/h2-17,19-20,22-27,40H,1,18,21H2,(H-,41,45,46)/p+2 |
| InChIKey | LAYREANSGFOLSH-UHFFFAOYSA-P |
| XLogP | 5.72 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.69 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|