C14H23NO2 — CID 123654969
1-(3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)-5-hydroxypentan-1-one (PubChem CID 123654969) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is 1-(3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)-5-hydroxypentan-1-one.
| Compound Name | 1-(3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)-5-hydroxypentan-1-one |
|---|---|
| PubChem CID | 123654969 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | 1-(3,4,4a,5,6,7-hexahydro-1H-isoquinolin-2-yl)-5-hydroxypentan-1-one |
| SMILES | O=C(CCCCO)N1CCC2CCCC=C2C1 |
| InChI | InChI=1S/C14H23NO2/c16-10-4-3-7-14(17)15-9-8-12-5-1-2-6-13(12)11-15/h6,12,16H,1-5,7-11H2 |
| InChIKey | VIGZTUWVBOCLHU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|