About 2-(dimethylamino)ethyl N-methylmethanimidothioate
2-(dimethylamino)ethyl N-methylmethanimidothioate (PubChem CID 123655015) has the molecular formula C6H14N2S
and a molecular weight of 146.26 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl N-methylmethanimidothioate.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl N-methylmethanimidothioate |
| PubChem CID | 123655015 |
| Molecular Formula | C6H14N2S |
| Molecular Weight | 146.26 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | 2-(dimethylamino)ethyl N-methylmethanimidothioate |
| SMILES | C/N=C/SCCN(C)C |
| InChI | InChI=1S/C6H14N2S/c1-7-6-9-5-4-8(2)3/h6H,4-5H2,1-3H3/b7-6+ |
| InChIKey | DXRDMMGFKLWQNM-VOTSOKGWSA-N |
| XLogP | 0.94 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethyl N-methylmethanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl N-methylmethanimidothioate?
The IUPAC name of 2-(dimethylamino)ethyl N-methylmethanimidothioate (CID 123655015) is 2-(dimethylamino)ethyl N-methylmethanimidothioate.
What is the SMILES notation for 2-(dimethylamino)ethyl N-methylmethanimidothioate?
The canonical SMILES for 2-(dimethylamino)ethyl N-methylmethanimidothioate is C/N=C/SCCN(C)C.
What is the InChIKey of 2-(dimethylamino)ethyl N-methylmethanimidothioate?
The InChIKey is DXRDMMGFKLWQNM-VOTSOKGWSA-N. The full InChI is InChI=1S/C6H14N2S/c1-7-6-9-5-4-8(2)3/h6H,4-5H2,1-3H3/b7-6+.
What are the key properties of 2-(dimethylamino)ethyl N-methylmethanimidothioate?
2-(dimethylamino)ethyl N-methylmethanimidothioate has a molecular weight of 146.26 g/mol, XLogP of 0.94, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl N-methylmethanimidothioate is sourced from PubChem (CID 123655015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).