C27H25FN4O3 — CID 123655289
N-[2-(4-fluorophenoxy)ethyl]-4-[(4-pyrazol-1-ylphenyl)methyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide (PubChem CID 123655289) has the molecular formula C27H25FN4O3 and a molecular weight of 472.52 g/mol. Its IUPAC name is N-[2-(4-fluorophenoxy)ethyl]-4-[(4-pyrazol-1-ylphenyl)methyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide.
| Compound Name | N-[2-(4-fluorophenoxy)ethyl]-4-[(4-pyrazol-1-ylphenyl)methyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 123655289 |
| Molecular Formula | C27H25FN4O3 |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | N-[2-(4-fluorophenoxy)ethyl]-4-[(4-pyrazol-1-ylphenyl)methyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| SMILES | O=C(NCCOc1ccc(F)cc1)C1CN(Cc2ccc(-n3cccn3)cc2)c2ccccc2O1 |
| InChI | InChI=1S/C27H25FN4O3/c28-21-8-12-23(13-9-21)34-17-15-29-27(33)26-19-31(24-4-1-2-5-25(24)35-26)18-20-6-10-22(11-7-20)32-16-3-14-30-32/h1-14,16,26H,15,17-19H2,(H,29,33) |
| InChIKey | FKMJVEJTSBRSNV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|