C22H25N3O4 — CID 123655992
[2-(1,3-benzoxazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2,6-dimethoxyphenyl)methanol (PubChem CID 123655992) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is [2-(1,3-benzoxazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2,6-dimethoxyphenyl)methanol.
| Compound Name | [2-(1,3-benzoxazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2,6-dimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 123655992 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | [2-(1,3-benzoxazol-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2,6-dimethoxyphenyl)methanol |
| SMILES | COc1cccc(OC)c1C(O)N1CC2CN(c3nc4ccccc4o3)CC2C1 |
| InChI | InChI=1S/C22H25N3O4/c1-27-18-8-5-9-19(28-2)20(18)21(26)24-10-14-12-25(13-15(14)11-24)22-23-16-6-3-4-7-17(16)29-22/h3-9,14-15,21,26H,10-13H2,1-2H3 |
| InChIKey | RMVOEELUHRBLJR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 71.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |