C21H30O5 — CID 123656067
[(5S,7S,10S,13S)-7-hydroxy-10,13-dimethyl-3,16-dioxo-2,4,5,6,7,8,9,11,12,14,15,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 123656067) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is [(5S,7S,10S,13S)-7-hydroxy-10,13-dimethyl-3,16-dioxo-2,4,5,6,7,8,9,11,12,14,15,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(5S,7S,10S,13S)-7-hydroxy-10,13-dimethyl-3,16-dioxo-2,4,5,6,7,8,9,11,12,14,15,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 123656067 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | [(5S,7S,10S,13S)-7-hydroxy-10,13-dimethyl-3,16-dioxo-2,4,5,6,7,8,9,11,12,14,15,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)OC1C(=O)CC2C3C(O)C[C@H]4CC(=O)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C21H30O5/c1-11(22)26-19-17(25)10-15-18-14(5-7-21(15,19)3)20(2)6-4-13(23)8-12(20)9-16(18)24/h12,14-16,18-19,24H,4-10H2,1-3H3/t12-,14?,15?,16?,18?,19?,20+,21+/m1/s1 |
| InChIKey | ILPHSHOCFUMFPX-YIXBEJJWSA-N |
| XLogP | 2.68 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |