C13H26N2O — CID 123656279
4-[1-[2-(methylamino)ethyl]-2,3,6,7-tetrahydroazepin-4-yl]butan-2-ol (PubChem CID 123656279) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is 4-[1-[2-(methylamino)ethyl]-2,3,6,7-tetrahydroazepin-4-yl]butan-2-ol.
| Compound Name | 4-[1-[2-(methylamino)ethyl]-2,3,6,7-tetrahydroazepin-4-yl]butan-2-ol |
|---|---|
| PubChem CID | 123656279 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | 4-[1-[2-(methylamino)ethyl]-2,3,6,7-tetrahydroazepin-4-yl]butan-2-ol |
| SMILES | CNCCN1CCC=C(CCC(C)O)CC1 |
| InChI | InChI=1S/C13H26N2O/c1-12(16)5-6-13-4-3-9-15(10-7-13)11-8-14-2/h4,12,14,16H,3,5-11H2,1-2H3 |
| InChIKey | BLBRCZQFRCPXKR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|