C18H23N3O3S — CID 123656296
3-(4-hydroxyphenyl)-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]imidazo[4,5-b]pyridin-2-one (PubChem CID 123656296) has the molecular formula C18H23N3O3S and a molecular weight of 361.47 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]imidazo[4,5-b]pyridin-2-one.
| Compound Name | 3-(4-hydroxyphenyl)-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]imidazo[4,5-b]pyridin-2-one |
|---|---|
| PubChem CID | 123656296 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 3-(4-hydroxyphenyl)-1-[2-(trimethyl-λ4-sulfanyl)ethoxymethyl]imidazo[4,5-b]pyridin-2-one |
| SMILES | CS(C)(C)CCOCn1c(=O)n(-c2ccc(O)cc2)c2ncccc21 |
| InChI | InChI=1S/C18H23N3O3S/c1-25(2,3)12-11-24-13-20-16-5-4-10-19-17(16)21(18(20)23)14-6-8-15(22)9-7-14/h4-10,22H,11-13H2,1-3H3 |
| InChIKey | UQHYBIQWXCRWQX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|