C28H22ClN5O2 — CID 123656456
3-[2-amino-4-[1-(8-chloro-1-oxo-2-phenylisoquinolin-3-yl)ethylamino]pyrimidin-5-yl]benzaldehyde (PubChem CID 123656456) has the molecular formula C28H22ClN5O2 and a molecular weight of 495.97 g/mol. Its IUPAC name is 3-[2-amino-4-[1-(8-chloro-1-oxo-2-phenylisoquinolin-3-yl)ethylamino]pyrimidin-5-yl]benzaldehyde.
| Compound Name | 3-[2-amino-4-[1-(8-chloro-1-oxo-2-phenylisoquinolin-3-yl)ethylamino]pyrimidin-5-yl]benzaldehyde |
|---|---|
| PubChem CID | 123656456 |
| Molecular Formula | C28H22ClN5O2 |
| Molecular Weight | 495.97 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | 3-[2-amino-4-[1-(8-chloro-1-oxo-2-phenylisoquinolin-3-yl)ethylamino]pyrimidin-5-yl]benzaldehyde |
| SMILES | CC(Nc1nc(N)ncc1-c1cccc(C=O)c1)c1cc2cccc(Cl)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C28H22ClN5O2/c1-17(32-26-22(15-31-28(30)33-26)19-8-5-7-18(13-19)16-35)24-14-20-9-6-12-23(29)25(20)27(36)34(24)21-10-3-2-4-11-21/h2-17H,1H3,(H3,30,31,32,33) |
| InChIKey | KXGKPRSOBUCSAB-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.97 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|