C42H72 — CID 123656550
(6aR,10aS,11aS)-1-[3-(cyclohexylmethyl)cyclohexyl]-4,5,6,6a,7,9,10a,11a-octamethyl-8-propan-2-yl-2,3,4,4a,5,5a,6,7,10,11,12,12a-dodecahydro-1H-tetracene (PubChem CID 123656550) has the molecular formula C42H72 and a molecular weight of 577.04 g/mol. Its IUPAC name is (6aR,10aS,11aS)-1-[3-(cyclohexylmethyl)cyclohexyl]-4,5,6,6a,7,9,10a,11a-octamethyl-8-propan-2-yl-2,3,4,4a,5,5a,6,7,10,11,12,12a-dodecahydro-1H-tetracene.
| Compound Name | (6aR,10aS,11aS)-1-[3-(cyclohexylmethyl)cyclohexyl]-4,5,6,6a,7,9,10a,11a-octamethyl-8-propan-2-yl-2,3,4,4a,5,5a,6,7,10,11,12,12a-dodecahydro-1H-tetracene |
|---|---|
| PubChem CID | 123656550 |
| Molecular Formula | C42H72 |
| Molecular Weight | 577.04 g/mol |
| Exact Mass | 576.56 |
| IUPAC Name | (6aR,10aS,11aS)-1-[3-(cyclohexylmethyl)cyclohexyl]-4,5,6,6a,7,9,10a,11a-octamethyl-8-propan-2-yl-2,3,4,4a,5,5a,6,7,10,11,12,12a-dodecahydro-1H-tetracene |
| SMILES | CC1=C(C(C)C)C(C)[C@@]2(C)C(C)C3C(C)C4C(C)CCC(C5CCCC(CC6CCCCC6)C5)C4C[C@@]3(C)C[C@@]2(C)C1 |
| InChI | InChI=1S/C42H72/c1-26(2)37-28(4)23-41(9)25-40(8)24-36-35(34-18-14-17-33(22-34)21-32-15-12-11-13-16-32)20-19-27(3)38(36)29(5)39(40)31(7)42(41,10)30(37)6/h26-27,29-36,38-39H,11-25H2,1-10H3/t27?,29?,30?,31?,33?,34?,35?,36?,38?,39?,40-,41+,42-/m0/s1 |
| InChIKey | QUPGNFVNXWSREB-XHKHPLOKSA-N |
| XLogP | 12.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.04 |
| LogP ≤ 5 | 12.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|