C8H12N2 — CID 123657629
2,3,4,4a-tetrahydro-1H-pyrido[1,2-c]pyrimidine (PubChem CID 123657629) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is 2,3,4,4a-tetrahydro-1H-pyrido[1,2-c]pyrimidine.
| Compound Name | 2,3,4,4a-tetrahydro-1H-pyrido[1,2-c]pyrimidine |
|---|---|
| PubChem CID | 123657629 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 2,3,4,4a-tetrahydro-1H-pyrido[1,2-c]pyrimidine |
| SMILES | C1=CC2CCNCN2C=C1 |
| InChI | InChI=1S/C8H12N2/c1-2-6-10-7-9-5-4-8(10)3-1/h1-3,6,8-9H,4-5,7H2 |
| InChIKey | PPYAADMNGBWEGL-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |