About 1-(2-methylcyclopropyl)nonadeca-4,9-dien-1-imine
1-(2-methylcyclopropyl)nonadeca-4,9-dien-1-imine (PubChem CID 123657658) has the molecular formula C23H41N
and a molecular weight of 331.59 g/mol. Its IUPAC name is 1-(2-methylcyclopropyl)nonadeca-4,9-dien-1-imine.
Molecular Properties
| Compound Name | 1-(2-methylcyclopropyl)nonadeca-4,9-dien-1-imine |
| PubChem CID | 123657658 |
| Molecular Formula | C23H41N |
| Molecular Weight | 331.59 g/mol |
| Exact Mass | 331.32 |
| IUPAC Name | 1-(2-methylcyclopropyl)nonadeca-4,9-dien-1-imine |
| SMILES | [H]/N=C(\CCC=CCCCC=CCCCCCCCCC)C1CC1C |
| InChI | InChI=1S/C23H41N/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23(24)22-20-21(22)2/h11-12,16-17,21-22,24H,3-10,13-15,18-20H2,1-2H3/b12-11?,17-16?,24-23+ |
| InChIKey | IEDHITBYZNTYLM-ZSFCZPSUSA-N |
| XLogP | 7.87 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.59 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-methylcyclopropyl)nonadeca-4,9-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methylcyclopropyl)nonadeca-4,9-dien-1-imine?
The IUPAC name of 1-(2-methylcyclopropyl)nonadeca-4,9-dien-1-imine (CID 123657658) is 1-(2-methylcyclopropyl)nonadeca-4,9-dien-1-imine.
What is the SMILES notation for 1-(2-methylcyclopropyl)nonadeca-4,9-dien-1-imine?
The canonical SMILES for 1-(2-methylcyclopropyl)nonadeca-4,9-dien-1-imine is [H]/N=C(\CCC=CCCCC=CCCCCCCCCC)C1CC1C.
What is the InChIKey of 1-(2-methylcyclopropyl)nonadeca-4,9-dien-1-imine?
The InChIKey is IEDHITBYZNTYLM-ZSFCZPSUSA-N. The full InChI is InChI=1S/C23H41N/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23(24)22-20-21(22)2/h11-12,16-17,21-22,24H,3-10,13-15,18-20H2,1-2H3/b12-11?,17-16?,24-23+.
What are the key properties of 1-(2-methylcyclopropyl)nonadeca-4,9-dien-1-imine?
1-(2-methylcyclopropyl)nonadeca-4,9-dien-1-imine has a molecular weight of 331.59 g/mol, XLogP of 7.87, 16 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methylcyclopropyl)nonadeca-4,9-dien-1-imine is sourced from PubChem (CID 123657658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).