About 6-methylhepta-2,5-dien-2-ylcyclopropane
6-methylhepta-2,5-dien-2-ylcyclopropane (PubChem CID 123658092) has the molecular formula C11H18
and a molecular weight of 150.26 g/mol. Its IUPAC name is 6-methylhepta-2,5-dien-2-ylcyclopropane.
Molecular Properties
| Compound Name | 6-methylhepta-2,5-dien-2-ylcyclopropane |
| PubChem CID | 123658092 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | 6-methylhepta-2,5-dien-2-ylcyclopropane |
| SMILES | CC(C)=CCC=C(C)C1CC1 |
| InChI | InChI=1S/C11H18/c1-9(2)5-4-6-10(3)11-7-8-11/h5-6,11H,4,7-8H2,1-3H3 |
| InChIKey | ZGHWXSXJYDPWEX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-methylhepta-2,5-dien-2-ylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylhepta-2,5-dien-2-ylcyclopropane?
The IUPAC name of 6-methylhepta-2,5-dien-2-ylcyclopropane (CID 123658092) is 6-methylhepta-2,5-dien-2-ylcyclopropane.
What is the SMILES notation for 6-methylhepta-2,5-dien-2-ylcyclopropane?
The canonical SMILES for 6-methylhepta-2,5-dien-2-ylcyclopropane is CC(C)=CCC=C(C)C1CC1.
What is the InChIKey of 6-methylhepta-2,5-dien-2-ylcyclopropane?
The InChIKey is ZGHWXSXJYDPWEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18/c1-9(2)5-4-6-10(3)11-7-8-11/h5-6,11H,4,7-8H2,1-3H3.
What are the key properties of 6-methylhepta-2,5-dien-2-ylcyclopropane?
6-methylhepta-2,5-dien-2-ylcyclopropane has a molecular weight of 150.26 g/mol, XLogP of 3.70, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylhepta-2,5-dien-2-ylcyclopropane is sourced from PubChem (CID 123658092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).