C13H6Br2F4O6S2 — CID 123658401
4-bromo-3-[(2-bromo-3,6-difluoro-5-sulfophenyl)methyl]-2,5-difluorobenzenesulfonic acid (PubChem CID 123658401) has the molecular formula C13H6Br2F4O6S2 and a molecular weight of 558.12 g/mol. Its IUPAC name is 4-bromo-3-[(2-bromo-3,6-difluoro-5-sulfophenyl)methyl]-2,5-difluorobenzenesulfonic acid.
| Compound Name | 4-bromo-3-[(2-bromo-3,6-difluoro-5-sulfophenyl)methyl]-2,5-difluorobenzenesulfonic acid |
|---|---|
| PubChem CID | 123658401 |
| Molecular Formula | C13H6Br2F4O6S2 |
| Molecular Weight | 558.12 g/mol |
| Exact Mass | 555.79 |
| IUPAC Name | 4-bromo-3-[(2-bromo-3,6-difluoro-5-sulfophenyl)methyl]-2,5-difluorobenzenesulfonic acid |
| SMILES | O=S(=O)(O)c1cc(F)c(Br)c(Cc2c(F)c(S(=O)(=O)O)cc(F)c2Br)c1F |
| InChI | InChI=1S/C13H6Br2F4O6S2/c14-10-4(12(18)8(2-6(10)16)26(20,21)22)1-5-11(15)7(17)3-9(13(5)19)27(23,24)25/h2-3H,1H2,(H,20,21,22)(H,23,24,25) |
| InChIKey | YZSGXGAZUHVHKG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.12 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|