C34H35N3O15 — CID 123658710
N-[7,11-bis[(2,3-dihydroxybenzoyl)amino]-2,6,10-trioxo-1,5,9-trioxacyclododec-3-yl]-6,7-dioxo-4-propan-2-ylcycloheptene-1-carboxamide (PubChem CID 123658710) has the molecular formula C34H35N3O15 and a molecular weight of 725.66 g/mol. Its IUPAC name is N-[7,11-bis[(2,3-dihydroxybenzoyl)amino]-2,6,10-trioxo-1,5,9-trioxacyclododec-3-yl]-6,7-dioxo-4-propan-2-ylcycloheptene-1-carboxamide.
| Compound Name | N-[7,11-bis[(2,3-dihydroxybenzoyl)amino]-2,6,10-trioxo-1,5,9-trioxacyclododec-3-yl]-6,7-dioxo-4-propan-2-ylcycloheptene-1-carboxamide |
|---|---|
| PubChem CID | 123658710 |
| Molecular Formula | C34H35N3O15 |
| Molecular Weight | 725.66 g/mol |
| Exact Mass | 725.21 |
| IUPAC Name | N-[7,11-bis[(2,3-dihydroxybenzoyl)amino]-2,6,10-trioxo-1,5,9-trioxacyclododec-3-yl]-6,7-dioxo-4-propan-2-ylcycloheptene-1-carboxamide |
| SMILES | CC(C)C1CC=C(C(=O)NC2COC(=O)C(NC(=O)c3cccc(O)c3O)COC(=O)C(NC(=O)c3cccc(O)c3O)COC2=O)C(=O)C(=O)C1 |
| InChI | InChI=1S/C34H35N3O15/c1-15(2)16-9-10-19(28(43)25(40)11-16)31(46)37-22-14-52-33(48)20(35-29(44)17-5-3-7-23(38)26(17)41)12-50-32(47)21(13-51-34(22)49)36-30(45)18-6-4-8-24(39)27(18)42/h3-8,10,15-16,20-22,38-39,41-42H,9,11-14H2,1-2H3,(H,35,44)(H,36,45)(H,37,46) |
| InChIKey | OODQHKIUFCKPOJ-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 281.26 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.66 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|