C29H29ClFN7O4 — CID 123658930
5-amino-14-[[1-(3-chloro-2-fluorophenyl)-5-methyl-4,5-dihydrotriazole-4-carbonyl]amino]-10-methyl-9-oxo-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2,4,6,15,17-hexaene-4-carboxylic acid (PubChem CID 123658930) has the molecular formula C29H29ClFN7O4 and a molecular weight of 594.05 g/mol. Its IUPAC name is 5-amino-14-[[1-(3-chloro-2-fluorophenyl)-5-methyl-4,5-dihydrotriazole-4-carbonyl]amino]-10-methyl-9-oxo-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2,4,6,15,17-hexaene-4-carboxylic acid.
| Compound Name | 5-amino-14-[[1-(3-chloro-2-fluorophenyl)-5-methyl-4,5-dihydrotriazole-4-carbonyl]amino]-10-methyl-9-oxo-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2,4,6,15,17-hexaene-4-carboxylic acid |
|---|---|
| PubChem CID | 123658930 |
| Molecular Formula | C29H29ClFN7O4 |
| Molecular Weight | 594.05 g/mol |
| Exact Mass | 593.20 |
| IUPAC Name | 5-amino-14-[[1-(3-chloro-2-fluorophenyl)-5-methyl-4,5-dihydrotriazole-4-carbonyl]amino]-10-methyl-9-oxo-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2,4,6,15,17-hexaene-4-carboxylic acid |
| SMILES | CC1CCCC(NC(=O)C2N=NN(c3cccc(Cl)c3F)C2C)c2cc(ccn2)-c2cc(C(=O)O)c(N)cc2NC1=O |
| InChI | InChI=1S/C29H29ClFN7O4/c1-14-5-3-7-21(34-28(40)26-15(2)38(37-36-26)24-8-4-6-19(30)25(24)31)23-11-16(9-10-33-23)17-12-18(29(41)42)20(32)13-22(17)35-27(14)39/h4,6,8-15,21,26H,3,5,7,32H2,1-2H3,(H,34,40)(H,35,39)(H,41,42) |
| InChIKey | QTBGRVBSQQKZBO-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 162.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.05 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|