C20H30BrN5O2 — CID 123659064
1-N-[1-amino-2-(4-bromophenyl)-2,3-dimethylbutylidene]-4-N,4-N-dimethylpiperazine-1,4-dicarboxamide (PubChem CID 123659064) has the molecular formula C20H30BrN5O2 and a molecular weight of 452.40 g/mol. Its IUPAC name is 1-N-[1-amino-2-(4-bromophenyl)-2,3-dimethylbutylidene]-4-N,4-N-dimethylpiperazine-1,4-dicarboxamide.
| Compound Name | 1-N-[1-amino-2-(4-bromophenyl)-2,3-dimethylbutylidene]-4-N,4-N-dimethylpiperazine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 123659064 |
| Molecular Formula | C20H30BrN5O2 |
| Molecular Weight | 452.40 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 1-N-[1-amino-2-(4-bromophenyl)-2,3-dimethylbutylidene]-4-N,4-N-dimethylpiperazine-1,4-dicarboxamide |
| SMILES | CC(C)C(C)(C(N)=NC(=O)N1CCN(C(=O)N(C)C)CC1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H30BrN5O2/c1-14(2)20(3,15-6-8-16(21)9-7-15)17(22)23-18(27)25-10-12-26(13-11-25)19(28)24(4)5/h6-9,14H,10-13H2,1-5H3,(H2,22,23,27) |
| InChIKey | VGOUGSCMDRLBMC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 82.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|