About 1-benzhydryl-2,5-bis(hydroxymethyl)pyrrolidine-3,4-diol
1-benzhydryl-2,5-bis(hydroxymethyl)pyrrolidine-3,4-diol (PubChem CID 123659205) has the molecular formula C19H23NO4
and a molecular weight of 329.40 g/mol. Its IUPAC name is 1-benzhydryl-2,5-bis(hydroxymethyl)pyrrolidine-3,4-diol.
Molecular Properties
| Compound Name | 1-benzhydryl-2,5-bis(hydroxymethyl)pyrrolidine-3,4-diol |
| PubChem CID | 123659205 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 1-benzhydryl-2,5-bis(hydroxymethyl)pyrrolidine-3,4-diol |
| SMILES | OCC1C(O)C(O)C(CO)N1C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H23NO4/c21-11-15-18(23)19(24)16(12-22)20(15)17(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15-19,21-24H,11-12H2 |
| InChIKey | VWTMBCHKRFCFFM-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-benzhydryl-2,5-bis(hydroxymethyl)pyrrolidine-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzhydryl-2,5-bis(hydroxymethyl)pyrrolidine-3,4-diol?
The IUPAC name of 1-benzhydryl-2,5-bis(hydroxymethyl)pyrrolidine-3,4-diol (CID 123659205) is 1-benzhydryl-2,5-bis(hydroxymethyl)pyrrolidine-3,4-diol.
What is the SMILES notation for 1-benzhydryl-2,5-bis(hydroxymethyl)pyrrolidine-3,4-diol?
The canonical SMILES for 1-benzhydryl-2,5-bis(hydroxymethyl)pyrrolidine-3,4-diol is OCC1C(O)C(O)C(CO)N1C(c1ccccc1)c1ccccc1.
What is the InChIKey of 1-benzhydryl-2,5-bis(hydroxymethyl)pyrrolidine-3,4-diol?
The InChIKey is VWTMBCHKRFCFFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23NO4/c21-11-15-18(23)19(24)16(12-22)20(15)17(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15-19,21-24H,11-12H2.
What are the key properties of 1-benzhydryl-2,5-bis(hydroxymethyl)pyrrolidine-3,4-diol?
1-benzhydryl-2,5-bis(hydroxymethyl)pyrrolidine-3,4-diol has a molecular weight of 329.40 g/mol, XLogP of 0.54, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzhydryl-2,5-bis(hydroxymethyl)pyrrolidine-3,4-diol is sourced from PubChem (CID 123659205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).