About 3-butan-2-yl-2,3-dihydropyran-6-one
3-butan-2-yl-2,3-dihydropyran-6-one (PubChem CID 123659399) has the molecular formula C9H14O2
and a molecular weight of 154.21 g/mol. Its IUPAC name is 3-butan-2-yl-2,3-dihydropyran-6-one.
Molecular Properties
| Compound Name | 3-butan-2-yl-2,3-dihydropyran-6-one |
| PubChem CID | 123659399 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | 3-butan-2-yl-2,3-dihydropyran-6-one |
| SMILES | CCC(C)C1C=CC(=O)OC1 |
| InChI | InChI=1S/C9H14O2/c1-3-7(2)8-4-5-9(10)11-6-8/h4-5,7-8H,3,6H2,1-2H3 |
| InChIKey | SMANQCBXGBENCF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-butan-2-yl-2,3-dihydropyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butan-2-yl-2,3-dihydropyran-6-one?
The IUPAC name of 3-butan-2-yl-2,3-dihydropyran-6-one (CID 123659399) is 3-butan-2-yl-2,3-dihydropyran-6-one.
What is the SMILES notation for 3-butan-2-yl-2,3-dihydropyran-6-one?
The canonical SMILES for 3-butan-2-yl-2,3-dihydropyran-6-one is CCC(C)C1C=CC(=O)OC1.
What is the InChIKey of 3-butan-2-yl-2,3-dihydropyran-6-one?
The InChIKey is SMANQCBXGBENCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2/c1-3-7(2)8-4-5-9(10)11-6-8/h4-5,7-8H,3,6H2,1-2H3.
What are the key properties of 3-butan-2-yl-2,3-dihydropyran-6-one?
3-butan-2-yl-2,3-dihydropyran-6-one has a molecular weight of 154.21 g/mol, XLogP of 1.76, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butan-2-yl-2,3-dihydropyran-6-one is sourced from PubChem (CID 123659399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).