About N-(2-fluorocyclopropyl)-5-methyl-2-methylidenenona-3,7-dienamide
N-(2-fluorocyclopropyl)-5-methyl-2-methylidenenona-3,7-dienamide (PubChem CID 123659516) has the molecular formula C14H20FNO
and a molecular weight of 237.32 g/mol. Its IUPAC name is N-(2-fluorocyclopropyl)-5-methyl-2-methylidenenona-3,7-dienamide.
Molecular Properties
| Compound Name | N-(2-fluorocyclopropyl)-5-methyl-2-methylidenenona-3,7-dienamide |
| PubChem CID | 123659516 |
| Molecular Formula | C14H20FNO |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | N-(2-fluorocyclopropyl)-5-methyl-2-methylidenenona-3,7-dienamide |
| SMILES | C=C(C=CC(C)CC=CC)C(=O)NC1CC1F |
| InChI | InChI=1S/C14H20FNO/c1-4-5-6-10(2)7-8-11(3)14(17)16-13-9-12(13)15/h4-5,7-8,10,12-13H,3,6,9H2,1-2H3,(H,16,17) |
| InChIKey | MVQBKGSNMMCUFQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(2-fluorocyclopropyl)-5-methyl-2-methylidenenona-3,7-dienamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-fluorocyclopropyl)-5-methyl-2-methylidenenona-3,7-dienamide?
The IUPAC name of N-(2-fluorocyclopropyl)-5-methyl-2-methylidenenona-3,7-dienamide (CID 123659516) is N-(2-fluorocyclopropyl)-5-methyl-2-methylidenenona-3,7-dienamide.
What is the SMILES notation for N-(2-fluorocyclopropyl)-5-methyl-2-methylidenenona-3,7-dienamide?
The canonical SMILES for N-(2-fluorocyclopropyl)-5-methyl-2-methylidenenona-3,7-dienamide is C=C(C=CC(C)CC=CC)C(=O)NC1CC1F.
What is the InChIKey of N-(2-fluorocyclopropyl)-5-methyl-2-methylidenenona-3,7-dienamide?
The InChIKey is MVQBKGSNMMCUFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20FNO/c1-4-5-6-10(2)7-8-11(3)14(17)16-13-9-12(13)15/h4-5,7-8,10,12-13H,3,6,9H2,1-2H3,(H,16,17).
What are the key properties of N-(2-fluorocyclopropyl)-5-methyl-2-methylidenenona-3,7-dienamide?
N-(2-fluorocyclopropyl)-5-methyl-2-methylidenenona-3,7-dienamide has a molecular weight of 237.32 g/mol, XLogP of 2.93, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-fluorocyclopropyl)-5-methyl-2-methylidenenona-3,7-dienamide is sourced from PubChem (CID 123659516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).