C16H31NO4 — CID 123659569
1-[hydroxy(2,5,5-trimethylhexan-2-yloxy)methyl]piperidine-4-carboxylic acid (PubChem CID 123659569) has the molecular formula C16H31NO4 and a molecular weight of 301.43 g/mol. Its IUPAC name is 1-[hydroxy(2,5,5-trimethylhexan-2-yloxy)methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[hydroxy(2,5,5-trimethylhexan-2-yloxy)methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 123659569 |
| Molecular Formula | C16H31NO4 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.23 |
| IUPAC Name | 1-[hydroxy(2,5,5-trimethylhexan-2-yloxy)methyl]piperidine-4-carboxylic acid |
| SMILES | CC(C)(C)CCC(C)(C)OC(O)N1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C16H31NO4/c1-15(2,3)8-9-16(4,5)21-14(20)17-10-6-12(7-11-17)13(18)19/h12,14,20H,6-11H2,1-5H3,(H,18,19) |
| InChIKey | WWTHDILZAGXGMC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|