C29H38Cl2F2N4O4S — CID 123659872
2-[[2-(2,6-dichloro-3-methylphenyl)sulfonyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-1-yl]methoxy]-N-[3-(4,4-difluoropiperidin-1-yl)cyclohexyl]propanamide (PubChem CID 123659872) has the molecular formula C29H38Cl2F2N4O4S and a molecular weight of 647.62 g/mol. Its IUPAC name is 2-[[2-(2,6-dichloro-3-methylphenyl)sulfonyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-1-yl]methoxy]-N-[3-(4,4-difluoropiperidin-1-yl)cyclohexyl]propanamide.
| Compound Name | 2-[[2-(2,6-dichloro-3-methylphenyl)sulfonyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-1-yl]methoxy]-N-[3-(4,4-difluoropiperidin-1-yl)cyclohexyl]propanamide |
|---|---|
| PubChem CID | 123659872 |
| Molecular Formula | C29H38Cl2F2N4O4S |
| Molecular Weight | 647.62 g/mol |
| Exact Mass | 646.20 |
| IUPAC Name | 2-[[2-(2,6-dichloro-3-methylphenyl)sulfonyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-1-yl]methoxy]-N-[3-(4,4-difluoropiperidin-1-yl)cyclohexyl]propanamide |
| SMILES | Cc1ccc(Cl)c(S(=O)(=O)N2CCn3cccc3C2COC(C)C(=O)NC2CCCC(N3CCC(F)(F)CC3)C2)c1Cl |
| InChI | InChI=1S/C29H38Cl2F2N4O4S/c1-19-8-9-23(30)27(26(19)31)42(39,40)37-16-15-36-12-4-7-24(36)25(37)18-41-20(2)28(38)34-21-5-3-6-22(17-21)35-13-10-29(32,33)11-14-35/h4,7-9,12,20-22,25H,3,5-6,10-11,13-18H2,1-2H3,(H,34,38) |
| InChIKey | DQHQMAOFMVWSSU-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.62 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |