About butyl-(6,8-dimethylundec-5-en-5-yl)-methylideneazanium
butyl-(6,8-dimethylundec-5-en-5-yl)-methylideneazanium (PubChem CID 123660095) has the molecular formula C18H36N+
and a molecular weight of 266.49 g/mol. Its IUPAC name is butyl-(6,8-dimethylundec-5-en-5-yl)-methylideneazanium.
Molecular Properties
| Compound Name | butyl-(6,8-dimethylundec-5-en-5-yl)-methylideneazanium |
| PubChem CID | 123660095 |
| Molecular Formula | C18H36N+ |
| Molecular Weight | 266.49 g/mol |
| Exact Mass | 266.28 |
| IUPAC Name | butyl-(6,8-dimethylundec-5-en-5-yl)-methylideneazanium |
| SMILES | C=[N+](CCCC)C(CCCC)=C(C)CC(C)CCC |
| InChI | InChI=1S/C18H36N/c1-7-10-13-18(19(6)14-11-8-2)17(5)15-16(4)12-9-3/h16H,6-15H2,1-5H3/q+1 |
| InChIKey | PIUZKAIGGJJSHV-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 266.49 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze butyl-(6,8-dimethylundec-5-en-5-yl)-methylideneazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl-(6,8-dimethylundec-5-en-5-yl)-methylideneazanium?
The IUPAC name of butyl-(6,8-dimethylundec-5-en-5-yl)-methylideneazanium (CID 123660095) is butyl-(6,8-dimethylundec-5-en-5-yl)-methylideneazanium.
What is the SMILES notation for butyl-(6,8-dimethylundec-5-en-5-yl)-methylideneazanium?
The canonical SMILES for butyl-(6,8-dimethylundec-5-en-5-yl)-methylideneazanium is C=[N+](CCCC)C(CCCC)=C(C)CC(C)CCC.
What is the InChIKey of butyl-(6,8-dimethylundec-5-en-5-yl)-methylideneazanium?
The InChIKey is PIUZKAIGGJJSHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36N/c1-7-10-13-18(19(6)14-11-8-2)17(5)15-16(4)12-9-3/h16H,6-15H2,1-5H3/q+1.
What are the key properties of butyl-(6,8-dimethylundec-5-en-5-yl)-methylideneazanium?
butyl-(6,8-dimethylundec-5-en-5-yl)-methylideneazanium has a molecular weight of 266.49 g/mol, XLogP of 5.79, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butyl-(6,8-dimethylundec-5-en-5-yl)-methylideneazanium is sourced from PubChem (CID 123660095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).