C18H27O2P — CID 123660151
1-[cyclohexen-1-yl(cyclohex-2-en-1-yloxy)phosphoryl]cyclohexene (PubChem CID 123660151) has the molecular formula C18H27O2P and a molecular weight of 306.39 g/mol. Its IUPAC name is 1-[cyclohexen-1-yl(cyclohex-2-en-1-yloxy)phosphoryl]cyclohexene.
| Compound Name | 1-[cyclohexen-1-yl(cyclohex-2-en-1-yloxy)phosphoryl]cyclohexene |
|---|---|
| PubChem CID | 123660151 |
| Molecular Formula | C18H27O2P |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 1-[cyclohexen-1-yl(cyclohex-2-en-1-yloxy)phosphoryl]cyclohexene |
| SMILES | O=P(OC1C=CCCC1)(C1=CCCCC1)C1=CCCCC1 |
| InChI | InChI=1S/C18H27O2P/c19-21(17-12-6-2-7-13-17,18-14-8-3-9-15-18)20-16-10-4-1-5-11-16/h4,10,12,14,16H,1-3,5-9,11,13,15H2 |
| InChIKey | STMFNJHPFMMTQO-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|