C18H24N4OS — CID 123660368
1-[3-[4-(methylaminomethyl)cyclohexyl]-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaen-4-yl]ethanol (PubChem CID 123660368) has the molecular formula C18H24N4OS and a molecular weight of 344.48 g/mol. Its IUPAC name is 1-[3-[4-(methylaminomethyl)cyclohexyl]-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaen-4-yl]ethanol.
| Compound Name | 1-[3-[4-(methylaminomethyl)cyclohexyl]-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaen-4-yl]ethanol |
|---|---|
| PubChem CID | 123660368 |
| Molecular Formula | C18H24N4OS |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 1-[3-[4-(methylaminomethyl)cyclohexyl]-12-thia-3,5,8-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,10-pentaen-4-yl]ethanol |
| SMILES | CNCC1CCC(n2c(C(C)O)nc3cnc4ccsc4c32)CC1 |
| InChI | InChI=1S/C18H24N4OS/c1-11(23)18-21-15-10-20-14-7-8-24-17(14)16(15)22(18)13-5-3-12(4-6-13)9-19-2/h7-8,10-13,19,23H,3-6,9H2,1-2H3 |
| InChIKey | BGWAAHYOFJUYEU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |