About 4-(2-tert-butyl-4,4-dimethylpent-1-enyl)phenol
4-(2-tert-butyl-4,4-dimethylpent-1-enyl)phenol (PubChem CID 123660421) has the molecular formula C17H26O
and a molecular weight of 246.39 g/mol. Its IUPAC name is 4-(2-tert-butyl-4,4-dimethylpent-1-enyl)phenol.
Molecular Properties
| Compound Name | 4-(2-tert-butyl-4,4-dimethylpent-1-enyl)phenol |
| PubChem CID | 123660421 |
| Molecular Formula | C17H26O |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.20 |
| IUPAC Name | 4-(2-tert-butyl-4,4-dimethylpent-1-enyl)phenol |
| SMILES | CC(C)(C)CC(=Cc1ccc(O)cc1)C(C)(C)C |
| InChI | InChI=1S/C17H26O/c1-16(2,3)12-14(17(4,5)6)11-13-7-9-15(18)10-8-13/h7-11,18H,12H2,1-6H3 |
| InChIKey | XUZLLDZSCLLRQM-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(2-tert-butyl-4,4-dimethylpent-1-enyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-tert-butyl-4,4-dimethylpent-1-enyl)phenol?
The IUPAC name of 4-(2-tert-butyl-4,4-dimethylpent-1-enyl)phenol (CID 123660421) is 4-(2-tert-butyl-4,4-dimethylpent-1-enyl)phenol.
What is the SMILES notation for 4-(2-tert-butyl-4,4-dimethylpent-1-enyl)phenol?
The canonical SMILES for 4-(2-tert-butyl-4,4-dimethylpent-1-enyl)phenol is CC(C)(C)CC(=Cc1ccc(O)cc1)C(C)(C)C.
What is the InChIKey of 4-(2-tert-butyl-4,4-dimethylpent-1-enyl)phenol?
The InChIKey is XUZLLDZSCLLRQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26O/c1-16(2,3)12-14(17(4,5)6)11-13-7-9-15(18)10-8-13/h7-11,18H,12H2,1-6H3.
What are the key properties of 4-(2-tert-butyl-4,4-dimethylpent-1-enyl)phenol?
4-(2-tert-butyl-4,4-dimethylpent-1-enyl)phenol has a molecular weight of 246.39 g/mol, XLogP of 5.26, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-tert-butyl-4,4-dimethylpent-1-enyl)phenol is sourced from PubChem (CID 123660421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).