C18H20N5O3+ — CID 123660539
6-(1-methylpyrazolo[1,5-a]pyrimidin-1-ium-3-yl)-4-(oxan-4-ylamino)pyridine-3-carboxylic acid (PubChem CID 123660539) has the molecular formula C18H20N5O3+ and a molecular weight of 354.39 g/mol. Its IUPAC name is 6-(1-methylpyrazolo[1,5-a]pyrimidin-1-ium-3-yl)-4-(oxan-4-ylamino)pyridine-3-carboxylic acid.
| Compound Name | 6-(1-methylpyrazolo[1,5-a]pyrimidin-1-ium-3-yl)-4-(oxan-4-ylamino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 123660539 |
| Molecular Formula | C18H20N5O3+ |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 6-(1-methylpyrazolo[1,5-a]pyrimidin-1-ium-3-yl)-4-(oxan-4-ylamino)pyridine-3-carboxylic acid |
| SMILES | C[n+]1cc(-c2cc(NC3CCOCC3)c(C(=O)O)cn2)c2ncccn21 |
| InChI | InChI=1S/C18H19N5O3/c1-22-11-14(17-19-5-2-6-23(17)22)15-9-16(13(10-20-15)18(24)25)21-12-3-7-26-8-4-12/h2,5-6,9-12H,3-4,7-8H2,1H3,(H-,20,21,24,25)/p+1 |
| InChIKey | GNWGGFVLZSKALW-UHFFFAOYSA-O |
| XLogP | 1.51 |
| TPSA | 92.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|