About 2-hydroxy-3-propan-2-yl-1,2-dihydropyrimidin-6-one
2-hydroxy-3-propan-2-yl-1,2-dihydropyrimidin-6-one (PubChem CID 123660651) has the molecular formula C7H12N2O2
and a molecular weight of 156.19 g/mol. Its IUPAC name is 2-hydroxy-3-propan-2-yl-1,2-dihydropyrimidin-6-one.
Molecular Properties
| Compound Name | 2-hydroxy-3-propan-2-yl-1,2-dihydropyrimidin-6-one |
| PubChem CID | 123660651 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 2-hydroxy-3-propan-2-yl-1,2-dihydropyrimidin-6-one |
| SMILES | CC(C)N1C=CC(=O)NC1O |
| InChI | InChI=1S/C7H12N2O2/c1-5(2)9-4-3-6(10)8-7(9)11/h3-5,7,11H,1-2H3,(H,8,10) |
| InChIKey | ZEQSNZWJMQQUEG-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxy-3-propan-2-yl-1,2-dihydropyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3-propan-2-yl-1,2-dihydropyrimidin-6-one?
The IUPAC name of 2-hydroxy-3-propan-2-yl-1,2-dihydropyrimidin-6-one (CID 123660651) is 2-hydroxy-3-propan-2-yl-1,2-dihydropyrimidin-6-one.
What is the SMILES notation for 2-hydroxy-3-propan-2-yl-1,2-dihydropyrimidin-6-one?
The canonical SMILES for 2-hydroxy-3-propan-2-yl-1,2-dihydropyrimidin-6-one is CC(C)N1C=CC(=O)NC1O.
What is the InChIKey of 2-hydroxy-3-propan-2-yl-1,2-dihydropyrimidin-6-one?
The InChIKey is ZEQSNZWJMQQUEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O2/c1-5(2)9-4-3-6(10)8-7(9)11/h3-5,7,11H,1-2H3,(H,8,10).
What are the key properties of 2-hydroxy-3-propan-2-yl-1,2-dihydropyrimidin-6-one?
2-hydroxy-3-propan-2-yl-1,2-dihydropyrimidin-6-one has a molecular weight of 156.19 g/mol, XLogP of -0.38, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3-propan-2-yl-1,2-dihydropyrimidin-6-one is sourced from PubChem (CID 123660651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).