C10H19N5 — CID 123660723
2-[1,2-bis(methylamino)ethyl]-1-ethenyl-3-prop-2-enylideneguanidine (PubChem CID 123660723) has the molecular formula C10H19N5 and a molecular weight of 209.30 g/mol. Its IUPAC name is 2-[1,2-bis(methylamino)ethyl]-1-ethenyl-3-prop-2-enylideneguanidine.
| Compound Name | 2-[1,2-bis(methylamino)ethyl]-1-ethenyl-3-prop-2-enylideneguanidine |
|---|---|
| PubChem CID | 123660723 |
| Molecular Formula | C10H19N5 |
| Molecular Weight | 209.30 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 2-[1,2-bis(methylamino)ethyl]-1-ethenyl-3-prop-2-enylideneguanidine |
| SMILES | C=CC=NC(=NC(CNC)NC)NC=C |
| InChI | InChI=1S/C10H19N5/c1-5-7-14-10(13-6-2)15-9(12-4)8-11-3/h5-7,9,11-12H,1-2,8H2,3-4H3,(H,13,15) |
| InChIKey | CZDLRNYFXNUHJJ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.30 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|