C17H28O — CID 123661034
4-(3,6,6-trimethyloctan-4-yl)phenol (PubChem CID 123661034) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is 4-(3,6,6-trimethyloctan-4-yl)phenol.
| Compound Name | 4-(3,6,6-trimethyloctan-4-yl)phenol |
|---|---|
| PubChem CID | 123661034 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | 4-(3,6,6-trimethyloctan-4-yl)phenol |
| SMILES | CCC(C)C(CC(C)(C)CC)c1ccc(O)cc1 |
| InChI | InChI=1S/C17H28O/c1-6-13(3)16(12-17(4,5)7-2)14-8-10-15(18)11-9-14/h8-11,13,16,18H,6-7,12H2,1-5H3 |
| InChIKey | WPSYALPGHCZJIM-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |