C25H28BNO6 — CID 123661204
(1R)-2-hydroxy-1-[(2S)-2-phenylmethoxycyclopentyl]-2-(3-phenyloxiran-2-yl)-3-oxa-1-azonia-2-boranuidabicyclo[3.2.1]octane-4,6-dione (PubChem CID 123661204) has the molecular formula C25H28BNO6 and a molecular weight of 449.31 g/mol. Its IUPAC name is (1R)-2-hydroxy-1-[(2S)-2-phenylmethoxycyclopentyl]-2-(3-phenyloxiran-2-yl)-3-oxa-1-azonia-2-boranuidabicyclo[3.2.1]octane-4,6-dione.
| Compound Name | (1R)-2-hydroxy-1-[(2S)-2-phenylmethoxycyclopentyl]-2-(3-phenyloxiran-2-yl)-3-oxa-1-azonia-2-boranuidabicyclo[3.2.1]octane-4,6-dione |
|---|---|
| PubChem CID | 123661204 |
| Molecular Formula | C25H28BNO6 |
| Molecular Weight | 449.31 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | (1R)-2-hydroxy-1-[(2S)-2-phenylmethoxycyclopentyl]-2-(3-phenyloxiran-2-yl)-3-oxa-1-azonia-2-boranuidabicyclo[3.2.1]octane-4,6-dione |
| SMILES | O=C1C[N@+]2(C3CCC[C@@H]3OCc3ccccc3)CC1C(=O)O[B-]2(O)C1OC1c1ccccc1 |
| InChI | InChI=1S/C25H28BNO6/c28-21-15-27(20-12-7-13-22(20)31-16-17-8-3-1-4-9-17)14-19(21)25(29)33-26(27,30)24-23(32-24)18-10-5-2-6-11-18/h1-6,8-11,19-20,22-24,30H,7,12-16H2/t19?,20?,22-,23?,24?,26?,27-/m0/s1 |
| InChIKey | UGWXRNKTYXBBAG-LOOGFVCOSA-N |
| XLogP | 2.31 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|