C31H54O3 — CID 123661228
(1S,2S,3R,4Z)-3-(3-hydroxypropyl)-4-(1-methoxyethylidene)-1,2-dimethyl-2-[(E)-4-methyl-6-[(1R,5S)-2,5,6,6-tetramethylcyclohex-2-en-1-yl]hex-3-enyl]cyclohexan-1-ol (PubChem CID 123661228) has the molecular formula C31H54O3 and a molecular weight of 474.77 g/mol. Its IUPAC name is (1S,2S,3R,4Z)-3-(3-hydroxypropyl)-4-(1-methoxyethylidene)-1,2-dimethyl-2-[(E)-4-methyl-6-[(1R,5S)-2,5,6,6-tetramethylcyclohex-2-en-1-yl]hex-3-enyl]cyclohexan-1-ol.
| Compound Name | (1S,2S,3R,4Z)-3-(3-hydroxypropyl)-4-(1-methoxyethylidene)-1,2-dimethyl-2-[(E)-4-methyl-6-[(1R,5S)-2,5,6,6-tetramethylcyclohex-2-en-1-yl]hex-3-enyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 123661228 |
| Molecular Formula | C31H54O3 |
| Molecular Weight | 474.77 g/mol |
| Exact Mass | 474.41 |
| IUPAC Name | (1S,2S,3R,4Z)-3-(3-hydroxypropyl)-4-(1-methoxyethylidene)-1,2-dimethyl-2-[(E)-4-methyl-6-[(1R,5S)-2,5,6,6-tetramethylcyclohex-2-en-1-yl]hex-3-enyl]cyclohexan-1-ol |
| SMILES | CO/C(C)=C1/CC[C@](C)(O)[C@@](C)(CC/C=C(\C)CC[C@@H]2C(C)=CC[C@H](C)C2(C)C)[C@@H]1CCCO |
| InChI | InChI=1S/C31H54O3/c1-22(14-17-27-23(2)15-16-24(3)29(27,5)6)12-10-19-30(7)28(13-11-21-32)26(25(4)34-9)18-20-31(30,8)33/h12,15,24,27-28,32-33H,10-11,13-14,16-21H2,1-9H3/b22-12+,26-25-/t24-,27+,28+,30-,31-/m0/s1 |
| InChIKey | BXLSQBGNEDEVHX-WUJPHOQYSA-N |
| XLogP | 7.98 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.77 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|