About hept-5-en-2-yldiazene
hept-5-en-2-yldiazene (PubChem CID 123661445) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is hept-5-en-2-yldiazene.
Molecular Properties
| Compound Name | hept-5-en-2-yldiazene |
| PubChem CID | 123661445 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | hept-5-en-2-yldiazene |
| SMILES | [H]/N=N/C(C)CCC=CC |
| InChI | InChI=1S/C7H14N2/c1-3-4-5-6-7(2)9-8/h3-4,7-8H,5-6H2,1-2H3/b4-3?,9-8+ |
| InChIKey | XUVUSGCQADVNJU-UCNKFEGYSA-N |
| XLogP | 2.76 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze hept-5-en-2-yldiazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hept-5-en-2-yldiazene?
The IUPAC name of hept-5-en-2-yldiazene (CID 123661445) is hept-5-en-2-yldiazene.
What is the SMILES notation for hept-5-en-2-yldiazene?
The canonical SMILES for hept-5-en-2-yldiazene is [H]/N=N/C(C)CCC=CC.
What is the InChIKey of hept-5-en-2-yldiazene?
The InChIKey is XUVUSGCQADVNJU-UCNKFEGYSA-N. The full InChI is InChI=1S/C7H14N2/c1-3-4-5-6-7(2)9-8/h3-4,7-8H,5-6H2,1-2H3/b4-3?,9-8+.
What are the key properties of hept-5-en-2-yldiazene?
hept-5-en-2-yldiazene has a molecular weight of 126.20 g/mol, XLogP of 2.76, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hept-5-en-2-yldiazene is sourced from PubChem (CID 123661445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).