About tert-butyl 5,5,5-trifluoro-4-methylpent-2-enoate
tert-butyl 5,5,5-trifluoro-4-methylpent-2-enoate (PubChem CID 123661596) has the molecular formula C10H15F3O2
and a molecular weight of 224.22 g/mol. Its IUPAC name is tert-butyl 5,5,5-trifluoro-4-methylpent-2-enoate.
Molecular Properties
| Compound Name | tert-butyl 5,5,5-trifluoro-4-methylpent-2-enoate |
| PubChem CID | 123661596 |
| Molecular Formula | C10H15F3O2 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | tert-butyl 5,5,5-trifluoro-4-methylpent-2-enoate |
| SMILES | CC(C=CC(=O)OC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C10H15F3O2/c1-7(10(11,12)13)5-6-8(14)15-9(2,3)4/h5-7H,1-4H3 |
| InChIKey | WTDSEZUJCLFVRC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 5,5,5-trifluoro-4-methylpent-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 5,5,5-trifluoro-4-methylpent-2-enoate?
The IUPAC name of tert-butyl 5,5,5-trifluoro-4-methylpent-2-enoate (CID 123661596) is tert-butyl 5,5,5-trifluoro-4-methylpent-2-enoate.
What is the SMILES notation for tert-butyl 5,5,5-trifluoro-4-methylpent-2-enoate?
The canonical SMILES for tert-butyl 5,5,5-trifluoro-4-methylpent-2-enoate is CC(C=CC(=O)OC(C)(C)C)C(F)(F)F.
What is the InChIKey of tert-butyl 5,5,5-trifluoro-4-methylpent-2-enoate?
The InChIKey is WTDSEZUJCLFVRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15F3O2/c1-7(10(11,12)13)5-6-8(14)15-9(2,3)4/h5-7H,1-4H3.
What are the key properties of tert-butyl 5,5,5-trifluoro-4-methylpent-2-enoate?
tert-butyl 5,5,5-trifluoro-4-methylpent-2-enoate has a molecular weight of 224.22 g/mol, XLogP of 3.08, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 5,5,5-trifluoro-4-methylpent-2-enoate is sourced from PubChem (CID 123661596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).