C25H20O4 — CID 123661645
2-(2-methoxyphenyl)-1,6-dimethylnaphtho[1,2-g][1]benzofuran-10,11-diol (PubChem CID 123661645) has the molecular formula C25H20O4 and a molecular weight of 384.43 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-1,6-dimethylnaphtho[1,2-g][1]benzofuran-10,11-diol.
| Compound Name | 2-(2-methoxyphenyl)-1,6-dimethylnaphtho[1,2-g][1]benzofuran-10,11-diol |
|---|---|
| PubChem CID | 123661645 |
| Molecular Formula | C25H20O4 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 2-(2-methoxyphenyl)-1,6-dimethylnaphtho[1,2-g][1]benzofuran-10,11-diol |
| SMILES | COc1ccccc1-c1oc2c(c1C)c(O)c(O)c1c3cccc(C)c3ccc21 |
| InChI | InChI=1S/C25H20O4/c1-13-7-6-9-16-15(13)11-12-18-21(16)23(27)22(26)20-14(2)24(29-25(18)20)17-8-4-5-10-19(17)28-3/h4-12,26-27H,1-3H3 |
| InChIKey | YORCVFUFKSRDOX-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|