C24H35NO5 — CID 123661665
5-[5-acetyloxy-6a-amino-6-(3-hydroxy-4-methyloct-1-en-6-ynyl)-1,3,3a,4,5,6-hexahydropentalen-2-ylidene]pentanoic acid (PubChem CID 123661665) has the molecular formula C24H35NO5 and a molecular weight of 417.55 g/mol. Its IUPAC name is 5-[5-acetyloxy-6a-amino-6-(3-hydroxy-4-methyloct-1-en-6-ynyl)-1,3,3a,4,5,6-hexahydropentalen-2-ylidene]pentanoic acid.
| Compound Name | 5-[5-acetyloxy-6a-amino-6-(3-hydroxy-4-methyloct-1-en-6-ynyl)-1,3,3a,4,5,6-hexahydropentalen-2-ylidene]pentanoic acid |
|---|---|
| PubChem CID | 123661665 |
| Molecular Formula | C24H35NO5 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | 5-[5-acetyloxy-6a-amino-6-(3-hydroxy-4-methyloct-1-en-6-ynyl)-1,3,3a,4,5,6-hexahydropentalen-2-ylidene]pentanoic acid |
| SMILES | CC#CCC(C)C(O)C=CC1C(OC(C)=O)CC2CC(=CCCCC(=O)O)CC21N |
| InChI | InChI=1S/C24H35NO5/c1-4-5-8-16(2)21(27)12-11-20-22(30-17(3)26)14-19-13-18(15-24(19,20)25)9-6-7-10-23(28)29/h9,11-12,16,19-22,27H,6-8,10,13-15,25H2,1-3H3,(H,28,29) |
| InChIKey | NOHVVKOYLMEZPH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|