C19H23N3O2 — CID 123662940
N-[2-(3-imidazol-1-ylpropyl)-4-propylphenyl]-1,4-dioxin-2-imine (PubChem CID 123662940) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is N-[2-(3-imidazol-1-ylpropyl)-4-propylphenyl]-1,4-dioxin-2-imine.
| Compound Name | N-[2-(3-imidazol-1-ylpropyl)-4-propylphenyl]-1,4-dioxin-2-imine |
|---|---|
| PubChem CID | 123662940 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | N-[2-(3-imidazol-1-ylpropyl)-4-propylphenyl]-1,4-dioxin-2-imine |
| SMILES | CCCc1ccc(/N=C2/COC=CO2)c(CCCn2ccnc2)c1 |
| InChI | InChI=1S/C19H23N3O2/c1-2-4-16-6-7-18(21-19-14-23-11-12-24-19)17(13-16)5-3-9-22-10-8-20-15-22/h6-8,10-13,15H,2-5,9,14H2,1H3/b21-19- |
| InChIKey | BHMMGZMDEVDYTD-VZCXRCSSSA-N |
| XLogP | 4.02 |
| TPSA | 48.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|