C9H17NS — CID 123663082
1-butylidene-N,3-dimethyl-2H-thiet-2-amine (PubChem CID 123663082) has the molecular formula C9H17NS and a molecular weight of 171.31 g/mol. Its IUPAC name is 1-butylidene-N,3-dimethyl-2H-thiet-2-amine.
| Compound Name | 1-butylidene-N,3-dimethyl-2H-thiet-2-amine |
|---|---|
| PubChem CID | 123663082 |
| Molecular Formula | C9H17NS |
| Molecular Weight | 171.31 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | 1-butylidene-N,3-dimethyl-2H-thiet-2-amine |
| SMILES | CCCC=S1C=C(C)C1NC |
| InChI | InChI=1S/C9H17NS/c1-4-5-6-11-7-8(2)9(11)10-3/h6-7,9-10H,4-5H2,1-3H3 |
| InChIKey | HDUMMSLPZWLDJL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|