C27H25N4O2+ — CID 123663149
3-[2-(3H-benzimidazol-1-ium-1-yl)ethynyl]-N-[4-[[(3R)-3-hydroxypyrrolidin-1-yl]methyl]phenyl]benzamide (PubChem CID 123663149) has the molecular formula C27H25N4O2+ and a molecular weight of 437.52 g/mol. Its IUPAC name is 3-[2-(3H-benzimidazol-1-ium-1-yl)ethynyl]-N-[4-[[(3R)-3-hydroxypyrrolidin-1-yl]methyl]phenyl]benzamide.
| Compound Name | 3-[2-(3H-benzimidazol-1-ium-1-yl)ethynyl]-N-[4-[[(3R)-3-hydroxypyrrolidin-1-yl]methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 123663149 |
| Molecular Formula | C27H25N4O2+ |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 3-[2-(3H-benzimidazol-1-ium-1-yl)ethynyl]-N-[4-[[(3R)-3-hydroxypyrrolidin-1-yl]methyl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(CN2CC[C@@H](O)C2)cc1)c1cccc(C#C[n+]2c[nH]c3ccccc32)c1 |
| InChI | InChI=1S/C27H24N4O2/c32-24-13-14-30(18-24)17-21-8-10-23(11-9-21)29-27(33)22-5-3-4-20(16-22)12-15-31-19-28-25-6-1-2-7-26(25)31/h1-11,16,19,24,32H,13-14,17-18H2,(H,29,33)/p+1/t24-/m1/s1 |
| InChIKey | RHRORGNGHVBQOE-XMMPIXPASA-O |
| XLogP | 3.13 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|