C42H48ClN2+ — CID 123663325
2-[2-[2-chloro-3-[2-(3-ethyl-1,1-dimethyl-3a,4,5,9b-tetrahydrobenzo[e]indol-3-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-3-ethyl-1,1-dimethylbenzo[e]indole (PubChem CID 123663325) has the molecular formula C42H48ClN2+ and a molecular weight of 616.31 g/mol. Its IUPAC name is 2-[2-[2-chloro-3-[2-(3-ethyl-1,1-dimethyl-3a,4,5,9b-tetrahydrobenzo[e]indol-3-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-3-ethyl-1,1-dimethylbenzo[e]indole.
| Compound Name | 2-[2-[2-chloro-3-[2-(3-ethyl-1,1-dimethyl-3a,4,5,9b-tetrahydrobenzo[e]indol-3-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-3-ethyl-1,1-dimethylbenzo[e]indole |
|---|---|
| PubChem CID | 123663325 |
| Molecular Formula | C42H48ClN2+ |
| Molecular Weight | 616.31 g/mol |
| Exact Mass | 615.35 |
| IUPAC Name | 2-[2-[2-chloro-3-[2-(3-ethyl-1,1-dimethyl-3a,4,5,9b-tetrahydrobenzo[e]indol-3-ium-2-yl)ethenyl]cyclohex-2-en-1-ylidene]ethylidene]-3-ethyl-1,1-dimethylbenzo[e]indole |
| SMILES | CCN1C(=CC=C2CCCC(C=CC3=[N+](CC)C4CCc5ccccc5C4C3(C)C)=C2Cl)C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C42H48ClN2/c1-7-44-34-24-20-28-14-9-11-18-32(28)38(34)41(3,4)36(44)26-22-30-16-13-17-31(40(30)43)23-27-37-42(5,6)39-33-19-12-10-15-29(33)21-25-35(39)45(37)8-2/h9-12,14-15,18-20,22-24,26-27,35,39H,7-8,13,16-17,21,25H2,1-6H3/q+1 |
| InChIKey | IOJGPJNVSKIJQF-UHFFFAOYSA-N |
| XLogP | 10.61 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.31 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|