C6H12N2O — CID 123663507
6,6-dimethyl-2,3-dihydro-1,4-oxazin-5-amine (PubChem CID 123663507) has the molecular formula C6H12N2O and a molecular weight of 128.17 g/mol. Its IUPAC name is 6,6-dimethyl-2,3-dihydro-1,4-oxazin-5-amine.
| Compound Name | 6,6-dimethyl-2,3-dihydro-1,4-oxazin-5-amine |
|---|---|
| PubChem CID | 123663507 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | 6,6-dimethyl-2,3-dihydro-1,4-oxazin-5-amine |
| SMILES | CC1(C)OCCN=C1N |
| InChI | InChI=1S/C6H12N2O/c1-6(2)5(7)8-3-4-9-6/h3-4H2,1-2H3,(H2,7,8) |
| InChIKey | PRWUFGYCSKWIPS-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |