C13H20O2 — CID 123663530
2-(5,6-dimethylocta-1,3,6-trienoxymethyl)oxirane (PubChem CID 123663530) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 2-(5,6-dimethylocta-1,3,6-trienoxymethyl)oxirane.
| Compound Name | 2-(5,6-dimethylocta-1,3,6-trienoxymethyl)oxirane |
|---|---|
| PubChem CID | 123663530 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 2-(5,6-dimethylocta-1,3,6-trienoxymethyl)oxirane |
| SMILES | CC=C(C)C(C)C=CC=COCC1CO1 |
| InChI | InChI=1S/C13H20O2/c1-4-11(2)12(3)7-5-6-8-14-9-13-10-15-13/h4-8,12-13H,9-10H2,1-3H3 |
| InChIKey | OROAHWGDJHAKSH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|