C21H24N4O6 — CID 123664849
(1-aminoethylideneamino) 1-methyl-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-6-oxo-4,5-dihydro-[1,2]oxazolo[5,4-d][2]benzazepine-8-carboxylate (PubChem CID 123664849) has the molecular formula C21H24N4O6 and a molecular weight of 428.45 g/mol. Its IUPAC name is (1-aminoethylideneamino) 1-methyl-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-6-oxo-4,5-dihydro-[1,2]oxazolo[5,4-d][2]benzazepine-8-carboxylate.
| Compound Name | (1-aminoethylideneamino) 1-methyl-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-6-oxo-4,5-dihydro-[1,2]oxazolo[5,4-d][2]benzazepine-8-carboxylate |
|---|---|
| PubChem CID | 123664849 |
| Molecular Formula | C21H24N4O6 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | (1-aminoethylideneamino) 1-methyl-4-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-6-oxo-4,5-dihydro-[1,2]oxazolo[5,4-d][2]benzazepine-8-carboxylate |
| SMILES | CC(N)=NOC(=O)c1ccc2c(c1)C(=O)NC(CC(=O)OC(C)(C)C)c1onc(C)c1-2 |
| InChI | InChI=1S/C21H24N4O6/c1-10-17-13-7-6-12(20(28)31-25-11(2)22)8-14(13)19(27)23-15(18(17)30-24-10)9-16(26)29-21(3,4)5/h6-8,15H,9H2,1-5H3,(H2,22,25)(H,23,27) |
| InChIKey | PIBJTWAKOJXIKI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 146.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|