About 2-[1-[4-(2,5-dimethylhexan-3-yl)phenoxy]ethylperoxy]-1,3-diphenylbenzene
2-[1-[4-(2,5-dimethylhexan-3-yl)phenoxy]ethylperoxy]-1,3-diphenylbenzene (PubChem CID 123664949) has the molecular formula C34H38O3
and a molecular weight of 494.68 g/mol. Its IUPAC name is 2-[1-[4-(2,5-dimethylhexan-3-yl)phenoxy]ethylperoxy]-1,3-diphenylbenzene.
Molecular Properties
| Compound Name | 2-[1-[4-(2,5-dimethylhexan-3-yl)phenoxy]ethylperoxy]-1,3-diphenylbenzene |
| PubChem CID | 123664949 |
| Molecular Formula | C34H38O3 |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | 2-[1-[4-(2,5-dimethylhexan-3-yl)phenoxy]ethylperoxy]-1,3-diphenylbenzene |
| SMILES | CC(C)CC(c1ccc(OC(C)OOc2c(-c3ccccc3)cccc2-c2ccccc2)cc1)C(C)C |
| InChI | InChI=1S/C34H38O3/c1-24(2)23-33(25(3)4)29-19-21-30(22-20-29)35-26(5)36-37-34-31(27-13-8-6-9-14-27)17-12-18-32(34)28-15-10-7-11-16-28/h6-22,24-26,33H,23H2,1-5H3 |
| InChIKey | KYXFHBYQZRPWOE-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-[4-(2,5-dimethylhexan-3-yl)phenoxy]ethylperoxy]-1,3-diphenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[4-(2,5-dimethylhexan-3-yl)phenoxy]ethylperoxy]-1,3-diphenylbenzene?
The IUPAC name of 2-[1-[4-(2,5-dimethylhexan-3-yl)phenoxy]ethylperoxy]-1,3-diphenylbenzene (CID 123664949) is 2-[1-[4-(2,5-dimethylhexan-3-yl)phenoxy]ethylperoxy]-1,3-diphenylbenzene.
What is the SMILES notation for 2-[1-[4-(2,5-dimethylhexan-3-yl)phenoxy]ethylperoxy]-1,3-diphenylbenzene?
The canonical SMILES for 2-[1-[4-(2,5-dimethylhexan-3-yl)phenoxy]ethylperoxy]-1,3-diphenylbenzene is CC(C)CC(c1ccc(OC(C)OOc2c(-c3ccccc3)cccc2-c2ccccc2)cc1)C(C)C.
What is the InChIKey of 2-[1-[4-(2,5-dimethylhexan-3-yl)phenoxy]ethylperoxy]-1,3-diphenylbenzene?
The InChIKey is KYXFHBYQZRPWOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H38O3/c1-24(2)23-33(25(3)4)29-19-21-30(22-20-29)35-26(5)36-37-34-31(27-13-8-6-9-14-27)17-12-18-32(34)28-15-10-7-11-16-28/h6-22,24-26,33H,23H2,1-5H3.
What are the key properties of 2-[1-[4-(2,5-dimethylhexan-3-yl)phenoxy]ethylperoxy]-1,3-diphenylbenzene?
2-[1-[4-(2,5-dimethylhexan-3-yl)phenoxy]ethylperoxy]-1,3-diphenylbenzene has a molecular weight of 494.68 g/mol, XLogP of 9.54, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[4-(2,5-dimethylhexan-3-yl)phenoxy]ethylperoxy]-1,3-diphenylbenzene is sourced from PubChem (CID 123664949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).