C23H23F2NO4 — CID 123665137
ethyl 3-[4-[2-[(2,6-difluorobenzoyl)amino]-2-methylpropanoyl]phenyl]-2-methylprop-2-enoate (PubChem CID 123665137) has the molecular formula C23H23F2NO4 and a molecular weight of 415.44 g/mol. Its IUPAC name is ethyl 3-[4-[2-[(2,6-difluorobenzoyl)amino]-2-methylpropanoyl]phenyl]-2-methylprop-2-enoate.
| Compound Name | ethyl 3-[4-[2-[(2,6-difluorobenzoyl)amino]-2-methylpropanoyl]phenyl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123665137 |
| Molecular Formula | C23H23F2NO4 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | ethyl 3-[4-[2-[(2,6-difluorobenzoyl)amino]-2-methylpropanoyl]phenyl]-2-methylprop-2-enoate |
| SMILES | CCOC(=O)C(C)=Cc1ccc(C(=O)C(C)(C)NC(=O)c2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C23H23F2NO4/c1-5-30-22(29)14(2)13-15-9-11-16(12-10-15)20(27)23(3,4)26-21(28)19-17(24)7-6-8-18(19)25/h6-13H,5H2,1-4H3,(H,26,28) |
| InChIKey | WDEAVHNGCHSRSC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|