C32H40N6O6Si — CID 123665296
2-[4-(2-methoxyacetyl)piperazin-1-yl]-2-[6-[[5-[2-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-2-pyridinyl]oxy]quinolin-2-yl]acetic acid (PubChem CID 123665296) has the molecular formula C32H40N6O6Si and a molecular weight of 632.79 g/mol. Its IUPAC name is 2-[4-(2-methoxyacetyl)piperazin-1-yl]-2-[6-[[5-[2-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-2-pyridinyl]oxy]quinolin-2-yl]acetic acid.
| Compound Name | 2-[4-(2-methoxyacetyl)piperazin-1-yl]-2-[6-[[5-[2-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-2-pyridinyl]oxy]quinolin-2-yl]acetic acid |
|---|---|
| PubChem CID | 123665296 |
| Molecular Formula | C32H40N6O6Si |
| Molecular Weight | 632.79 g/mol |
| Exact Mass | 632.28 |
| IUPAC Name | 2-[4-(2-methoxyacetyl)piperazin-1-yl]-2-[6-[[5-[2-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-2-pyridinyl]oxy]quinolin-2-yl]acetic acid |
| SMILES | COCC(=O)N1CCN(C(C(=O)O)c2ccc3cc(Oc4ccc(-c5ccnn5COCC[Si](C)(C)C)cn4)ccc3n2)CC1 |
| InChI | InChI=1S/C32H40N6O6Si/c1-42-21-30(39)36-13-15-37(16-14-36)31(32(40)41)27-8-5-23-19-25(7-9-26(23)35-27)44-29-10-6-24(20-33-29)28-11-12-34-38(28)22-43-17-18-45(2,3)4/h5-12,19-20,31H,13-18,21-22H2,1-4H3,(H,40,41) |
| InChIKey | YFALECULZQYJHV-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.79 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|