C12H22N4O — CID 123665656
4,4,6,6-tetramethyl-7-(2H-tetrazol-5-yl)heptan-2-one (PubChem CID 123665656) has the molecular formula C12H22N4O and a molecular weight of 238.33 g/mol. Its IUPAC name is 4,4,6,6-tetramethyl-7-(2H-tetrazol-5-yl)heptan-2-one.
| Compound Name | 4,4,6,6-tetramethyl-7-(2H-tetrazol-5-yl)heptan-2-one |
|---|---|
| PubChem CID | 123665656 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 4,4,6,6-tetramethyl-7-(2H-tetrazol-5-yl)heptan-2-one |
| SMILES | CC(=O)CC(C)(C)CC(C)(C)Cc1nn[nH]n1 |
| InChI | InChI=1S/C12H22N4O/c1-9(17)6-11(2,3)8-12(4,5)7-10-13-15-16-14-10/h6-8H2,1-5H3,(H,13,14,15,16) |
| InChIKey | LMMKPQWWDFKNBA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |