C14H20N2 — CID 123666070
3,3,11-trimethyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene (PubChem CID 123666070) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 3,3,11-trimethyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene.
| Compound Name | 3,3,11-trimethyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene |
|---|---|
| PubChem CID | 123666070 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 3,3,11-trimethyl-1,10-diazatricyclo[6.4.1.04,13]trideca-4,6,8(13)-triene |
| SMILES | CC1CN2CC(C)(C)c3cccc(c32)CN1 |
| InChI | InChI=1S/C14H20N2/c1-10-8-16-9-14(2,3)12-6-4-5-11(7-15-10)13(12)16/h4-6,10,15H,7-9H2,1-3H3 |
| InChIKey | JHDOBWGFBFDSFC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |