C17H27ClO — CID 123666154
(7Z,9Z)-5-(1-chloroethyl)-3,8-dimethyltrideca-7,9,11-trien-6-one (PubChem CID 123666154) has the molecular formula C17H27ClO and a molecular weight of 282.86 g/mol. Its IUPAC name is (7Z,9Z)-5-(1-chloroethyl)-3,8-dimethyltrideca-7,9,11-trien-6-one.
| Compound Name | (7Z,9Z)-5-(1-chloroethyl)-3,8-dimethyltrideca-7,9,11-trien-6-one |
|---|---|
| PubChem CID | 123666154 |
| Molecular Formula | C17H27ClO |
| Molecular Weight | 282.86 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | (7Z,9Z)-5-(1-chloroethyl)-3,8-dimethyltrideca-7,9,11-trien-6-one |
| SMILES | CC=C/C=C\C(C)=C/C(=O)C(CC(C)CC)C(C)Cl |
| InChI | InChI=1S/C17H27ClO/c1-6-8-9-10-14(4)12-17(19)16(15(5)18)11-13(3)7-2/h6,8-10,12-13,15-16H,7,11H2,1-5H3/b8-6?,10-9-,14-12- |
| InChIKey | STZABPBKZSUDLO-KPMIVDIESA-N |
| XLogP | 5.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.86 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|