About 5-bromo-2,4-diethoxypyridine
5-bromo-2,4-diethoxypyridine (PubChem CID 1236662) has the molecular formula C9H12BrNO2
and a molecular weight of 246.10 g/mol. Its IUPAC name is 5-bromo-2,4-diethoxypyridine.
Molecular Properties
| Compound Name | 5-bromo-2,4-diethoxypyridine |
| PubChem CID | 1236662 |
| Molecular Formula | C9H12BrNO2 |
| Molecular Weight | 246.10 g/mol |
| Exact Mass | 245.01 |
| IUPAC Name | 5-bromo-2,4-diethoxypyridine |
| SMILES | CCOc1cc(OCC)c(Br)cn1 |
| InChI | InChI=1S/C9H12BrNO2/c1-3-12-8-5-9(13-4-2)11-6-7(8)10/h5-6H,3-4H2,1-2H3 |
| InChIKey | IUHIHPJXZDJRMX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.10 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-2,4-diethoxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2,4-diethoxypyridine?
The IUPAC name of 5-bromo-2,4-diethoxypyridine (CID 1236662) is 5-bromo-2,4-diethoxypyridine.
What is the SMILES notation for 5-bromo-2,4-diethoxypyridine?
The canonical SMILES for 5-bromo-2,4-diethoxypyridine is CCOc1cc(OCC)c(Br)cn1.
What is the InChIKey of 5-bromo-2,4-diethoxypyridine?
The InChIKey is IUHIHPJXZDJRMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12BrNO2/c1-3-12-8-5-9(13-4-2)11-6-7(8)10/h5-6H,3-4H2,1-2H3.
What are the key properties of 5-bromo-2,4-diethoxypyridine?
5-bromo-2,4-diethoxypyridine has a molecular weight of 246.10 g/mol, XLogP of 2.64, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2,4-diethoxypyridine is sourced from PubChem (CID 1236662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).